Name: Polyvinyl Alcohol
Abbreviation: PVA
Molecular formula:[CH2CHOH]n
or[CH2CHOH]n-[CH2CHOOCCH3]m
Product Performance
PVA resin is a kind of heavy polymer,it is non-toxic, insipid and harmless. PVA is water-soluble
and the solvent provide good viscosity and film building. It can withstand oils, lubricants, hydrocarbons and most
other organic solvents. PVA has better chemical stability and insulatibility, and provide ease in firm building; It possess the typical chemical properties of
polyols and can carry out process of esterification, etherealization, aceatalization etc.
Technical
requirement
1. Appearance: white or light yellow floc, Granular or powdery in appearance.
2. Technical Index Partly alcoholysis products
Complaint
