Isomerism | - |
Chemical formula | C14H15N3 |
Canonical SMILES | CC1=NC(=NC(=C1)C2CC2)NC3=CC=CC=C3 |
Isomeric SMILES | No data |
International Chemical Identifier key (InChIKey) | HAORKNGNJCEJBX-UHFFFAOYSA-N |
International Chemical Identifier (InChI) | InChI=1S/C14H15N3/c1-10-9-13(11-7-8-11)17-14(15-10)16-12-5-3-2-4-6-12/h2-6,9,11H,7-8H2,1H3,(H,15,16,17) |
Pesticide type | Fungicide |
Substance group | Anilinopyrimidine |
Minimum active substance purity | 980 g/kg |
Known relevant impurities | EU dossier - None declared |
Substance origin | Synthetic |
Mode of action | Systemic, absorbed through foliage. Inhibits protein synthesis. |
CAS RN | 121552-61-2 |
EC number | - |
CIPAC number | 511 |
US EPA chemical code | 288202 |
PubChem CID | 86367 |
Molecular mass (g mol-1) | 225.29 |
PIN (Preferred Identification Name) | 4-cyclopropyl-6-methyl-N-phenylpyrimidin-2-amine |
IUPAC name | 4-cyclopropyl-6-methyl-N-phenylpyrimidin-2-amine |
CAS name | 4-cyclopropyl-6-methyl-N-phenyl-2-pyrimidinamine |
Isomerism | None |
Chemical formula | C12H6F2N2O2 |
Canonical SMILES | C1=CC(=C2C(=C1)OC(O2)(F)F)C3=CNC=C3C#N |
Isomeric SMILES | No data |
International Chemical Identifier key (InChIKey) | MUJOIMFVNIBMKC-UHFFFAOYSA-N |
International Chemical Identifier (InChI) | InChI=1S/C12H6F2N2O2/c13-12(14)17-10-3-1-2-8(11(10)18-12)9-6-16-5-7(9)4-15/h1-3,5-6,16H |
Pesticide type | Fungicide |
Substance group | Phenylpyrrole |
Minimum active substance purity | 950 g/kg |
Known relevant impurities | EU dossier - None declared |
Substance origin | Synthetic |
Mode of action | Non-systemic with long residual activity. Inhibits transport-associated phosphorylation of glucose, reducing mycelial growth. Osmotic signal transduction. |
CAS RN | 131341-86-1 |
EC number | - |
CIPAC number | 522 |
US EPA chemical code | 071503 |
PubChem CID | 86398 |
Molecular mass (g mol-1) | 248.19 |
PIN (Preferred Identification Name) | 4-(2,2-difluoro-2H-1,3-benzodioxol-4-yl)-1H-pyrrole-3-carbonitrile |
IUPAC name | 4-(2,2-difluoro-1,3-benzodioxol-4-yl)-1H-pyrrole-3-carbonitrile |
CAS name | 4-(2,2-difluoro-1,3-benzodioxol-4-yl)-1H-pyrrole-3-carbonitrile |