Isomerism | Exists as both E and Z isomers but the E-isomer is overwhelmingly favoured thermodynamically |
Chemical formula | C7H10N4O3 |
Canonical SMILES | CCNC(=O)NC(=O)C(=NOC)C#N |
Isomeric SMILES | CCNC(=O)NC(=O)/C(=N/OC)/C#N |
International Chemical Identifier key (InChIKey) | XERJKGMBORTKEO-UHFFFAOYSA-N |
International Chemical Identifier (InChI) | InChI=1S/C7H10N4O3/c1-3-9-7(13)10-6(12)5(4-8)11-14-2/h3H2,1-2H3,(H2,9,10,12,13)/b11-5+ |
Pesticide type | Fungicide |
Substance group | Cyanoacetamide oxime |
Minimum active substance purity | 970 g/kg |
Known relevant impurities | EU dossier - None declared |
Substance origin | Synthetic |
Mode of action | Foliar with protective and curative activity. |
CAS RN | 57966-95-7 |
EC number | 261-043-0 |
CIPAC number | 419 |
US EPA chemical code | 129106 |
PubChem CID | 5364079 |
Molecular mass (g mol-1) | 198.18 |
PIN (Preferred Identification Name) | (2E)-2-cyano-N-(ethylcarbamoyl)-2-(methoxyimino)acetamide |
IUPAC name | 1-[(EZ)-2-cyano-2-methoxyiminoacetyl]-3-ethylurea |
CAS name | 2-cyano-N-((ethylamino)carbonyl)-2-(methoxyimino)acetamide |
Isomerism | A molecule with one chiral feature. |
Chemical formula | C5H8N2S4Zn |
Canonical SMILES | CC(CNC(=S)[S-])NC(=S)[S-].[Zn+2] |
Isomeric SMILES | No data |
International Chemical Identifier key (InChIKey) | HLQULFUYWRYRJQ-UHFFFAOYSA-M |
International Chemical Identifier (InChI) | InChI=1S/C5H10N2S4.Zn/c1-3(7-5(10)11)2-6-4(8)9;/h3H,2H2,1H3,(H2,6,8,9)(H2,7,10,11);/q;+2/p-2/rC5H8N2S4Zn/c1-3-2-6-4(8)10-12-11-5(9)7-3/h3H,2H2,1H3,(H,6,8)(H,7,9) |
Pesticide type | Fungicide |
Substance group | Carbamate |
Minimum active substance purity | - |
Known relevant impurities | EU dossier: aresenic as an impurity |
Substance origin | Synthetic |
Mode of action | Contact action with protective properties and long residual activity. Multi-site activity. |
CAS RN | 12071-83-9 |
Alternative/old CAS RN | 9016-72-2 |
EC number | 235-134-0 |
CIPAC number | 177 |
US EPA chemical code | 522200 |
PubChem CID | 6100711 |
Molecular mass (g mol-1) | 289.80 |
PIN (Preferred Identification Name) | - |
IUPAC name | polymeric zinc propylenebis(dithiocarbamate) |
CAS name | ((2-((dithiocarboxy)amino)-1-methylethyl)carbamodithioato))(2-)-kS,kS')zinc |