Complaint
| Isomerism | A chiral molecule existing as two enantiomers |
| Chemical formula | C10H19O6PS2 |
| Canonical SMILES | CCOC(=O)CC(C(=O)OCC)SP(=S)(OC)OC |
| Isomeric SMILES | No data |
| International Chemical Identifier key (InChIKey) | JXSJBGJIGXNWCI-UHFFFAOYSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C10H19O6PS2/c1-5-15-9(11)7-8(10(12)16-6-2)19-17(18,13-3)14-4/h8H,5-7H2,1-4H3 |
| Pesticide type | Insecticide, Acaricide, Veterinary substance |
| Substance group | Organophosphate |
| Minimum active substance purity | 950 g/kg (racemic mixture) |
| Known relevant impurities | EU dossier - malaoxon <1g/kg, isomalathion <2g/kg, MeOOSPS-triester <15g/kg, MeOOOPS-triester 5g/kg |
| Substance origin | Synthetic |
| Mode of action | Broad-spectrum, non-systemic with contact, stomach and respiratory action. Acetylcholinesterase (AChE) inhibitor. |
| CAS RN | 121-75-5 |
| EC number | 204-497-7 |
| CIPAC number | 12 |
| US EPA chemical code | 057701 |
| PubChem CID | 4004 |
| Molecular mass (g mol-1) | 330.36 |
| Isomerism | A molecule with 2 chiral centres, fenvalerate is a mixture of four optical isomers which have different insecticidal activities. The 2-S alpha (or SS) configuration is the most insecticidally active isomer. |
| Chemical formula | C25H22ClNO3 |
| Canonical SMILES | CC(C)C(C1=CC=C(C=C1)Cl)C(=O)OC(C#N)C2=CC(=CC=C2)OC3=CC=CC=C3 |
| Isomeric SMILES | No data |
| International Chemical Identifier key (InChIKey) | NYPJDWWKZLNGGM-UHFFFAOYSA-N |
| International Chemical Identifier (InChI) | InChI=1S/C25H22ClNO3/c1-17(2)24(18-11-13-20(26)14-12-18)25(28)30-23(16-27)19-7-6-10-22(15-19)29-21-8-4-3-5-9-21/h3-15,17,23-24H,1-2H3 |
| Pesticide type | Insecticide, Acaricide, Termiticide, Veterinary substance |
| Substance group | Pyrethroid |
| Minimum active substance purity | 92% |
| Known relevant impurities | - |
| Substance origin | Synthetic |
| Mode of action | Non-systemic with contact and stomach action. Sodium channel modulator. |
| CAS RN | 51630-58-1 |
| EC number | 257-326-3 |
| CIPAC number | 334 |
| US EPA chemical code | 109301 |
| PubChem CID | 3347 |
| Molecular mass (g mol-1) | 419.90 |
| PIN (Preferred Identification Name) | (E)-cyano(3-phenoxyphenyl)methyl (2E)-2-(4-chlorophenyl)-3-methylbutanoate |
| IUPAC name | (RS)-α-cyano-3-phenoxybenzyl (RS)-2-(4-chlorophenyl)-3-methylbutyrate |
| CAS name | cyano(3-phenoxyphenyl)methyl 4-chloro-α-(1-methylethyl)benzeneacetate |
| Other status information | Chemical subject to PIC regulations |
