E Type Rail Clip for Railway Track

Min.Order: 1,000
Product origin: Suzhou, Jiangsu, China
Infringement complaint: complaintComplaint
US$ 0.8 ~ 1

Description
E Type Rail Clip for Railway Track used with railway sleeper to fasten rails on both sides. The rail clips are usually made of forged spring steel, which are manufactured by hot forging process. The forged rail clips are considered to be better than other metal forming process due to most uniform microstructure.
 
 
Material: Spring steel
1.60Si2MnA
2.60Si2CrA
3.55Si2Mn
4.38Si7

Clip Production Process
1. Raw material
2. Shearing
3. Heating to forging temperature (950-1000 degrees celsius)
4. Forming
5. Hardening
6. Tempering below 350 degrees celsius
7. Inspection
8. Packing

Standard
1. DIN17221
2. GB/T1222
3. BS970

Certification: ISO9001: 2008

Surface Treatment
1. Plain (oiled)
2. Color paint
3. Oxide Black
4. Galavazing
5. DHG

Application system: ( SKL2)
1. Iron tie plate
2. Rubber base plate
3. Skl elastic clip
4. Stud bolt, nut, washer
5. Screw spike

Similarity
1. E1609, E1809, E1817, E2007, E2009, E2055
2. PR series
3. SKL1, SKL2, SKL3, SKL12, SKL14
4. Deenik clip
5. Russia cli
6. Gauge lock clip
7. Nabla clip

Inspection machine
1. Brinell Hardness Tester
2. Carbon and Sulfur Analyzer
3. Rockwell Hardness Machine
4. Automatic Impact Testing Machine
5. Metallographic Microscope
6. Automatic High-speed Analyzer
7. Fatigue Testing Machine
8. Metallographic Specimen Polishing Machine
9. Metallographic Specimen Pointing Machine

Package:
1.25 kg double-layer woven bag with free fumigation wooden pallent
2.36bags/pallets
3.20pallets/20ft

Payment terms: 30% T/T deposit in advance, balance against Blcopy within 7 working days.

Service
1. Sample: Ok
2. Develop new model: Ok
3. Product mark: Customizable
4. Factory visit: Ok

Taicang Zhongbo Company profile
Taicang Zhongbo is now a leading and reputed manufacturer of qualified railway fasteners in China. 

Taicang Zhongbo Team
We have 5 senior engineers, 20 professional technicians and a group of highly experienced operation workers. We have our own R&D team, after-sales service team and quality-assurance team with the most advance technology and management concepts

W-type
    
Material60Si2MnA60Si2CrA55Si2Mn38Si7
Chemical composition(%)C:0.56-0.64, C:0.56-0.64, C:0.52-0.60, C:0.35-0.42, 
Mn:0.60-0.90, Mn:0.40-0.70, Mn:0.60-0.90, Mn:0.50-0.80,
Si:1.60-2.00, Si:1.40-1.80,Si:1.50-2.00,Si:1.50-1.80, 
Cr:≤0.35, Cr:0.70-1.00 Cr:≤0.35   
P:≤0.03, P:≤0.03, P:≤0.03, P:≤0.03, 
S:≤0.03S:≤0.03S:≤0.03S:≤0.03
Hardness42-47HRC
Fatigue lifefor Dia.18 is 3 millions cycles without breaking 
for Dia.20 is 5 millions cycles without breaking

Photo of E Type Rail Clip for Railway Track
Scroll to Top